C11H19NS — CID 12882480
(E)-N,N-diethyl-5-ethylsulfanylpent-4-en-2-yn-1-amine (PubChem CID 12882480) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is (E)-N,N-diethyl-5-ethylsulfanylpent-4-en-2-yn-1-amine.
| Compound Name | (E)-N,N-diethyl-5-ethylsulfanylpent-4-en-2-yn-1-amine |
|---|---|
| PubChem CID | 12882480 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (E)-N,N-diethyl-5-ethylsulfanylpent-4-en-2-yn-1-amine |
| SMILES | CCS/C=C/C#CCN(CC)CC |
| InChI | InChI=1S/C11H19NS/c1-4-12(5-2)10-8-7-9-11-13-6-3/h9,11H,4-6,10H2,1-3H3/b11-9+ |
| InChIKey | ZNPZGPZGTGRUOZ-PKNBQFBNSA-N |
| XLogP | 2.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|