C22H35N5O — CID 128830431
4-(1-benzylpyrrolidin-3-yl)-N-(2-methylpiperidin-4-yl)piperazine-1-carboxamide (PubChem CID 128830431) has the molecular formula C22H35N5O and a molecular weight of 385.56 g/mol. Its IUPAC name is 4-(1-benzylpyrrolidin-3-yl)-N-(2-methylpiperidin-4-yl)piperazine-1-carboxamide.
| Compound Name | 4-(1-benzylpyrrolidin-3-yl)-N-(2-methylpiperidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 128830431 |
| Molecular Formula | C22H35N5O |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 4-(1-benzylpyrrolidin-3-yl)-N-(2-methylpiperidin-4-yl)piperazine-1-carboxamide |
| SMILES | CC1CC(NC(=O)N2CCN(C3CCN(Cc4ccccc4)C3)CC2)CCN1 |
| InChI | InChI=1S/C22H35N5O/c1-18-15-20(7-9-23-18)24-22(28)27-13-11-26(12-14-27)21-8-10-25(17-21)16-19-5-3-2-4-6-19/h2-6,18,20-21,23H,7-17H2,1H3,(H,24,28) |
| InChIKey | ZZQKMWGFLMIBNE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |