C17H25N3O2 — CID 95556952
(2S)-4-(1-benzylpiperidin-4-yl)piperazine-2-carboxylic acid (PubChem CID 95556952) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (2S)-4-(1-benzylpiperidin-4-yl)piperazine-2-carboxylic acid.
| Compound Name | (2S)-4-(1-benzylpiperidin-4-yl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 95556952 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (2S)-4-(1-benzylpiperidin-4-yl)piperazine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(C2CCN(Cc3ccccc3)CC2)CCN1 |
| InChI | InChI=1S/C17H25N3O2/c21-17(22)16-13-20(11-8-18-16)15-6-9-19(10-7-15)12-14-4-2-1-3-5-14/h1-5,15-16,18H,6-13H2,(H,21,22)/t16-/m0/s1 |
| InChIKey | CQYYEMNVIKFBNS-INIZCTEOSA-N |
| XLogP | 1.01 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |