C10H15I3O2 — CID 12884029
2,3,3-triiodoprop-2-enoxymethoxycyclohexane (PubChem CID 12884029) has the molecular formula C10H15I3O2 and a molecular weight of 547.94 g/mol. Its IUPAC name is 2,3,3-triiodoprop-2-enoxymethoxycyclohexane.
| Compound Name | 2,3,3-triiodoprop-2-enoxymethoxycyclohexane |
|---|---|
| PubChem CID | 12884029 |
| Molecular Formula | C10H15I3O2 |
| Molecular Weight | 547.94 g/mol |
| Exact Mass | 547.82 |
| IUPAC Name | 2,3,3-triiodoprop-2-enoxymethoxycyclohexane |
| SMILES | IC(I)=C(I)COCOC1CCCCC1 |
| InChI | InChI=1S/C10H15I3O2/c11-9(10(12)13)6-14-7-15-8-4-2-1-3-5-8/h8H,1-7H2 |
| InChIKey | YOWTZMAOLVBMKR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|