C15H25NO4 — CID 91354255
1-[2-(cyclohexyloxymethoxy)ethyl]-3,4-dimethylpyrrole-2,5-diol (PubChem CID 91354255) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-[2-(cyclohexyloxymethoxy)ethyl]-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-[2-(cyclohexyloxymethoxy)ethyl]-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91354255 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 1-[2-(cyclohexyloxymethoxy)ethyl]-3,4-dimethylpyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(CCOCOC2CCCCC2)c1O |
| InChI | InChI=1S/C15H25NO4/c1-11-12(2)15(18)16(14(11)17)8-9-19-10-20-13-6-4-3-5-7-13/h13,17-18H,3-10H2,1-2H3 |
| InChIKey | WDPMZBDFCIPMFE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|