C11H9FN2OS — CID 12889653
3-(4-fluorophenyl)-5-(isothiocyanatomethyl)-4,5-dihydro-1,2-oxazole (PubChem CID 12889653) has the molecular formula C11H9FN2OS and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-(isothiocyanatomethyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 3-(4-fluorophenyl)-5-(isothiocyanatomethyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 12889653 |
| Molecular Formula | C11H9FN2OS |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(4-fluorophenyl)-5-(isothiocyanatomethyl)-4,5-dihydro-1,2-oxazole |
| SMILES | Fc1ccc(C2=NOC(CN=C=S)C2)cc1 |
| InChI | InChI=1S/C11H9FN2OS/c12-9-3-1-8(2-4-9)11-5-10(15-14-11)6-13-7-16/h1-4,10H,5-6H2 |
| InChIKey | JIBKUJKWYKAKMX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|