C13H16FNO — CID 135041813
5-butyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 135041813) has the molecular formula C13H16FNO and a molecular weight of 221.28 g/mol. Its IUPAC name is 5-butyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-butyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 135041813 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5-butyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | CCCCC1CC(c2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C13H16FNO/c1-2-3-4-12-9-13(15-16-12)10-5-7-11(14)8-6-10/h5-8,12H,2-4,9H2,1H3 |
| InChIKey | ZMXICNPRWWMLKO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |