C18H24N4OS — CID 128956684
N-(1-ethylpiperidin-4-yl)-2-(2-methylquinazolin-4-yl)sulfanylacetamide (PubChem CID 128956684) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is N-(1-ethylpiperidin-4-yl)-2-(2-methylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-(1-ethylpiperidin-4-yl)-2-(2-methylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 128956684 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-(1-ethylpiperidin-4-yl)-2-(2-methylquinazolin-4-yl)sulfanylacetamide |
| SMILES | CCN1CCC(NC(=O)CSc2nc(C)nc3ccccc23)CC1 |
| InChI | InChI=1S/C18H24N4OS/c1-3-22-10-8-14(9-11-22)21-17(23)12-24-18-15-6-4-5-7-16(15)19-13(2)20-18/h4-7,14H,3,8-12H2,1-2H3,(H,21,23) |
| InChIKey | KYLFEQCWRVIQAK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |