C9H13N5 — CID 12895924
N'-[(Z)-1,2-dicyano-2-(dimethylamino)ethenyl]-N,N-dimethylmethanimidamide (PubChem CID 12895924) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is N'-[(Z)-1,2-dicyano-2-(dimethylamino)ethenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[(Z)-1,2-dicyano-2-(dimethylamino)ethenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 12895924 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | N'-[(Z)-1,2-dicyano-2-(dimethylamino)ethenyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/C(C#N)=C(/C#N)N(C)C |
| InChI | InChI=1S/C9H13N5/c1-13(2)7-12-8(5-10)9(6-11)14(3)4/h7H,1-4H3/b9-8-,12-7+ |
| InChIKey | JZBHGGGGURETIS-ZHCAKQDLSA-N |
| XLogP | 0.40 |
| TPSA | 66.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|