C7H9N5 — CID 12942440
N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N,N-dimethylmethanimidamide (PubChem CID 12942440) has the molecular formula C7H9N5 and a molecular weight of 163.18 g/mol. Its IUPAC name is N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 12942440 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/C(C#N)=C(\N)C#N |
| InChI | InChI=1S/C7H9N5/c1-12(2)5-11-7(4-9)6(10)3-8/h5H,10H2,1-2H3/b7-6-,11-5+ |
| InChIKey | QWXILPIFKQNIMF-TUKAJDRUSA-N |
| XLogP | -0.21 |
| TPSA | 89.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|