C9H12N6 — CID 10679699
N'-[(Z)-1,2-dicyano-2-(methyliminomethylamino)ethenyl]-N,N-dimethylmethanimidamide (PubChem CID 10679699) has the molecular formula C9H12N6 and a molecular weight of 204.24 g/mol. Its IUPAC name is N'-[(Z)-1,2-dicyano-2-(methyliminomethylamino)ethenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[(Z)-1,2-dicyano-2-(methyliminomethylamino)ethenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 10679699 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | N'-[(Z)-1,2-dicyano-2-(methyliminomethylamino)ethenyl]-N,N-dimethylmethanimidamide |
| SMILES | C/N=C/N/C(C#N)=C(C#N)\N=C\N(C)C |
| InChI | InChI=1S/C9H12N6/c1-12-6-13-8(4-10)9(5-11)14-7-15(2)3/h6-7H,1-3H3,(H,12,13)/b9-8-,14-7+ |
| InChIKey | OSBZTVDWVPALKC-GBYAIJDDSA-N |
| XLogP | 0.08 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|