C19H24N4OS2 — CID 128970629
(3aS,6aS)-2-benzyl-N-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide (PubChem CID 128970629) has the molecular formula C19H24N4OS2 and a molecular weight of 388.56 g/mol. Its IUPAC name is (3aS,6aS)-2-benzyl-N-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide.
| Compound Name | (3aS,6aS)-2-benzyl-N-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 128970629 |
| Molecular Formula | C19H24N4OS2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (3aS,6aS)-2-benzyl-N-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide |
| SMILES | CSc1nnc(CNC(=O)[C@@]23CCC[C@@H]2CN(Cc2ccccc2)C3)s1 |
| InChI | InChI=1S/C19H24N4OS2/c1-25-18-22-21-16(26-18)10-20-17(24)19-9-5-8-15(19)12-23(13-19)11-14-6-3-2-4-7-14/h2-4,6-7,15H,5,8-13H2,1H3,(H,20,24)/t15-,19-/m1/s1 |
| InChIKey | QPBJPEYYCFUCKI-DNVCBOLYSA-N |
| XLogP | 3.18 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |