C14H22N2O3S — CID 128977205
N-[[(2S,3S)-4-ethyl-3-phenylmorpholin-2-yl]methyl]methanesulfonamide (PubChem CID 128977205) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-[[(2S,3S)-4-ethyl-3-phenylmorpholin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(2S,3S)-4-ethyl-3-phenylmorpholin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 128977205 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[[(2S,3S)-4-ethyl-3-phenylmorpholin-2-yl]methyl]methanesulfonamide |
| SMILES | CCN1CCO[C@@H](CNS(C)(=O)=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H22N2O3S/c1-3-16-9-10-19-13(11-15-20(2,17)18)14(16)12-7-5-4-6-8-12/h4-8,13-15H,3,9-11H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | XQHKTWBBTWPJBR-KBPBESRZSA-N |
| XLogP | 1.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |