C14H14ClN5O — CID 128977782
4-chloro-2-[3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]benzonitrile (PubChem CID 128977782) has the molecular formula C14H14ClN5O and a molecular weight of 303.75 g/mol. Its IUPAC name is 4-chloro-2-[3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]benzonitrile.
| Compound Name | 4-chloro-2-[3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 128977782 |
| Molecular Formula | C14H14ClN5O |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-chloro-2-[3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1N1CCCC(O)(c2cn[nH]n2)C1 |
| InChI | InChI=1S/C14H14ClN5O/c15-11-3-2-10(7-16)12(6-11)20-5-1-4-14(21,9-20)13-8-17-19-18-13/h2-3,6,8,21H,1,4-5,9H2,(H,17,18,19) |
| InChIKey | IRLBWTGXSRDTMF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |