C16H17N5O2 — CID 128980534
[3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]-(1H-indol-6-yl)methanone (PubChem CID 128980534) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is [3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]-(1H-indol-6-yl)methanone.
| Compound Name | [3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]-(1H-indol-6-yl)methanone |
|---|---|
| PubChem CID | 128980534 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | [3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]-(1H-indol-6-yl)methanone |
| SMILES | O=C(c1ccc2cc[nH]c2c1)N1CCCC(O)(c2cn[nH]n2)C1 |
| InChI | InChI=1S/C16H17N5O2/c22-15(12-3-2-11-4-6-17-13(11)8-12)21-7-1-5-16(23,10-21)14-9-18-20-19-14/h2-4,6,8-9,17,23H,1,5,7,10H2,(H,18,19,20) |
| InChIKey | AYRKODRGNATWPH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |