C18H21N5O2 — CID 167775691
(2,3-dimethyl-1H-indol-5-yl)-[3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]methanone (PubChem CID 167775691) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 167775691 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCCC(O)(c4cn[nH]n4)C3)cc2c1C |
| InChI | InChI=1S/C18H21N5O2/c1-11-12(2)20-15-5-4-13(8-14(11)15)17(24)23-7-3-6-18(25,10-23)16-9-19-22-21-16/h4-5,8-9,20,25H,3,6-7,10H2,1-2H3,(H,19,21,22) |
| InChIKey | BGKRHGPLVHXOLL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|