C14H14F3N5O2 — CID 128981886
[3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]-[3-(trifluoromethyl)-4-pyridinyl]methanone (PubChem CID 128981886) has the molecular formula C14H14F3N5O2 and a molecular weight of 341.29 g/mol. Its IUPAC name is [3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]-[3-(trifluoromethyl)-4-pyridinyl]methanone.
| Compound Name | [3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]-[3-(trifluoromethyl)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 128981886 |
| Molecular Formula | C14H14F3N5O2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [3-hydroxy-3-(2H-triazol-4-yl)piperidin-1-yl]-[3-(trifluoromethyl)-4-pyridinyl]methanone |
| SMILES | O=C(c1ccncc1C(F)(F)F)N1CCCC(O)(c2cn[nH]n2)C1 |
| InChI | InChI=1S/C14H14F3N5O2/c15-14(16,17)10-6-18-4-2-9(10)12(23)22-5-1-3-13(24,8-22)11-7-19-21-20-11/h2,4,6-7,24H,1,3,5,8H2,(H,19,20,21) |
| InChIKey | LIPKPEPNEXGZHN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |