C16H14ClN5O2 — CID 154756968
(6-chloroquinolin-8-yl)-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]methanone (PubChem CID 154756968) has the molecular formula C16H14ClN5O2 and a molecular weight of 343.77 g/mol. Its IUPAC name is (6-chloroquinolin-8-yl)-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (6-chloroquinolin-8-yl)-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 154756968 |
| Molecular Formula | C16H14ClN5O2 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (6-chloroquinolin-8-yl)-[3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)cc2cccnc12)N1CCC(O)(c2cn[nH]n2)C1 |
| InChI | InChI=1S/C16H14ClN5O2/c17-11-6-10-2-1-4-18-14(10)12(7-11)15(23)22-5-3-16(24,9-22)13-8-19-21-20-13/h1-2,4,6-8,24H,3,5,9H2,(H,19,20,21) |
| InChIKey | RNLYUPQKPIGPKA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |