C11H14ClN3O2 — CID 128978229
(2S,4S)-1-(3-chloro-2-pyridinyl)-4-methoxypyrrolidine-2-carboxamide (PubChem CID 128978229) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.71 g/mol. Its IUPAC name is (2S,4S)-1-(3-chloro-2-pyridinyl)-4-methoxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-(3-chloro-2-pyridinyl)-4-methoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 128978229 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (2S,4S)-1-(3-chloro-2-pyridinyl)-4-methoxypyrrolidine-2-carboxamide |
| SMILES | CO[C@H]1C[C@@H](C(N)=O)N(c2ncccc2Cl)C1 |
| InChI | InChI=1S/C11H14ClN3O2/c1-17-7-5-9(10(13)16)15(6-7)11-8(12)3-2-4-14-11/h2-4,7,9H,5-6H2,1H3,(H2,13,16)/t7-,9-/m0/s1 |
| InChIKey | MAHVNAQRTUZZGK-CBAPKCEASA-N |
| XLogP | 0.81 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |