C18H26N4O3 — CID 128981232
2-[1-(furan-2-ylmethyl)piperidin-3-yl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one (PubChem CID 128981232) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[1-(furan-2-ylmethyl)piperidin-3-yl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one.
| Compound Name | 2-[1-(furan-2-ylmethyl)piperidin-3-yl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 128981232 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-[1-(furan-2-ylmethyl)piperidin-3-yl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one |
| SMILES | COCCN(C)c1cnn(C2CCCN(Cc3ccco3)C2)c(=O)c1 |
| InChI | InChI=1S/C18H26N4O3/c1-20(8-10-24-2)16-11-18(23)22(19-12-16)15-5-3-7-21(13-15)14-17-6-4-9-25-17/h4,6,9,11-12,15H,3,5,7-8,10,13-14H2,1-2H3 |
| InChIKey | KROQKMURPOQOBZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |