C20H20ClIN2O2 — CID 1289850
2-chloro-N-[4-iodo-2-(4-methylpiperidine-1-carbonyl)phenyl]benzamide (PubChem CID 1289850) has the molecular formula C20H20ClIN2O2 and a molecular weight of 482.75 g/mol. Its IUPAC name is 2-chloro-N-[4-iodo-2-(4-methylpiperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 2-chloro-N-[4-iodo-2-(4-methylpiperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1289850 |
| Molecular Formula | C20H20ClIN2O2 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | 2-chloro-N-[4-iodo-2-(4-methylpiperidine-1-carbonyl)phenyl]benzamide |
| SMILES | CC1CCN(C(=O)c2cc(I)ccc2NC(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H20ClIN2O2/c1-13-8-10-24(11-9-13)20(26)16-12-14(22)6-7-18(16)23-19(25)15-4-2-3-5-17(15)21/h2-7,12-13H,8-11H2,1H3,(H,23,25) |
| InChIKey | WOAJWRWVJSPEIJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|