C19H18Cl2IN3O2 — CID 1304777
2,4-dichloro-N-[4-iodo-2-(4-methylpiperazine-1-carbonyl)phenyl]benzamide (PubChem CID 1304777) has the molecular formula C19H18Cl2IN3O2 and a molecular weight of 518.18 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-iodo-2-(4-methylpiperazine-1-carbonyl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-iodo-2-(4-methylpiperazine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1304777 |
| Molecular Formula | C19H18Cl2IN3O2 |
| Molecular Weight | 518.18 g/mol |
| Exact Mass | 516.98 |
| IUPAC Name | 2,4-dichloro-N-[4-iodo-2-(4-methylpiperazine-1-carbonyl)phenyl]benzamide |
| SMILES | CN1CCN(C(=O)c2cc(I)ccc2NC(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H18Cl2IN3O2/c1-24-6-8-25(9-7-24)19(27)15-11-13(22)3-5-17(15)23-18(26)14-4-2-12(20)10-16(14)21/h2-5,10-11H,6-9H2,1H3,(H,23,26) |
| InChIKey | QXRTWIOBWDGZPZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.18 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|