C17H18IN3O3 — CID 1289803
N-[4-iodo-2-(4-methylpiperazine-1-carbonyl)phenyl]furan-2-carboxamide (PubChem CID 1289803) has the molecular formula C17H18IN3O3 and a molecular weight of 439.25 g/mol. Its IUPAC name is N-[4-iodo-2-(4-methylpiperazine-1-carbonyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-iodo-2-(4-methylpiperazine-1-carbonyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1289803 |
| Molecular Formula | C17H18IN3O3 |
| Molecular Weight | 439.25 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | N-[4-iodo-2-(4-methylpiperazine-1-carbonyl)phenyl]furan-2-carboxamide |
| SMILES | CN1CCN(C(=O)c2cc(I)ccc2NC(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H18IN3O3/c1-20-6-8-21(9-7-20)17(23)13-11-12(18)4-5-14(13)19-16(22)15-3-2-10-24-15/h2-5,10-11H,6-9H2,1H3,(H,19,22) |
| InChIKey | BKSVSYZYXMIAMI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|