About 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol
2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol (PubChem CID 128991574) has the molecular formula C18H25ClN4O
and a molecular weight of 348.88 g/mol. Its IUPAC name is 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol |
| PubChem CID | 128991574 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cn([C@@H]2CCCC[C@@H]2NCc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C18H25ClN4O/c1-18(2,24)17-12-23(22-21-17)16-10-6-5-9-15(16)20-11-13-7-3-4-8-14(13)19/h3-4,7-8,12,15-16,20,24H,5-6,9-11H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | HTFAPQAZIJIJLS-JKSUJKDBSA-N |
| XLogP | 3.43 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol?
The IUPAC name of 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol (CID 128991574) is 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol.
What is the SMILES notation for 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol?
The canonical SMILES for 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol is CC(C)(O)c1cn([C@@H]2CCCC[C@@H]2NCc2ccccc2Cl)nn1.
What is the InChIKey of 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol?
The InChIKey is HTFAPQAZIJIJLS-JKSUJKDBSA-N. The full InChI is InChI=1S/C18H25ClN4O/c1-18(2,24)17-12-23(22-21-17)16-10-6-5-9-15(16)20-11-13-7-3-4-8-14(13)19/h3-4,7-8,12,15-16,20,24H,5-6,9-11H2,1-2H3/t15-,16+/m0/s1.
What are the key properties of 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol?
2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol has a molecular weight of 348.88 g/mol, XLogP of 3.43, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(1R,2S)-2-[(2-chlorophenyl)methylamino]cyclohexyl]triazol-4-yl]propan-2-ol is sourced from PubChem (CID 128991574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).