C23H25N5O3 — CID 128993642
3-(4-carbamoyl-1-phenylpyrazol-3-yl)-N-[(3-hydroxyphenyl)methyl]piperidine-1-carboxamide (PubChem CID 128993642) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 3-(4-carbamoyl-1-phenylpyrazol-3-yl)-N-[(3-hydroxyphenyl)methyl]piperidine-1-carboxamide.
| Compound Name | 3-(4-carbamoyl-1-phenylpyrazol-3-yl)-N-[(3-hydroxyphenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 128993642 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 3-(4-carbamoyl-1-phenylpyrazol-3-yl)-N-[(3-hydroxyphenyl)methyl]piperidine-1-carboxamide |
| SMILES | NC(=O)c1cn(-c2ccccc2)nc1C1CCCN(C(=O)NCc2cccc(O)c2)C1 |
| InChI | InChI=1S/C23H25N5O3/c24-22(30)20-15-28(18-8-2-1-3-9-18)26-21(20)17-7-5-11-27(14-17)23(31)25-13-16-6-4-10-19(29)12-16/h1-4,6,8-10,12,15,17,29H,5,7,11,13-14H2,(H2,24,30)(H,25,31) |
| InChIKey | QKNXBRGCOYHXRH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |