C21H20FN5O3 — CID 129323533
3-[(3R)-1-(4-fluoro-2-nitrophenyl)piperidin-3-yl]-1-phenylpyrazole-4-carboxamide (PubChem CID 129323533) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is 3-[(3R)-1-(4-fluoro-2-nitrophenyl)piperidin-3-yl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-[(3R)-1-(4-fluoro-2-nitrophenyl)piperidin-3-yl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 129323533 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-[(3R)-1-(4-fluoro-2-nitrophenyl)piperidin-3-yl]-1-phenylpyrazole-4-carboxamide |
| SMILES | NC(=O)c1cn(-c2ccccc2)nc1[C@@H]1CCCN(c2ccc(F)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H20FN5O3/c22-15-8-9-18(19(11-15)27(29)30)25-10-4-5-14(12-25)20-17(21(23)28)13-26(24-20)16-6-2-1-3-7-16/h1-3,6-9,11,13-14H,4-5,10,12H2,(H2,23,28)/t14-/m1/s1 |
| InChIKey | BNBZIHLQYUWGRW-CQSZACIVSA-N |
| XLogP | 3.40 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|