C22H26N6O — CID 129324409
N-ethyl-1-phenyl-3-[(3R)-1-(pyrimidin-5-ylmethyl)piperidin-3-yl]pyrazole-4-carboxamide (PubChem CID 129324409) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is N-ethyl-1-phenyl-3-[(3R)-1-(pyrimidin-5-ylmethyl)piperidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | N-ethyl-1-phenyl-3-[(3R)-1-(pyrimidin-5-ylmethyl)piperidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 129324409 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | N-ethyl-1-phenyl-3-[(3R)-1-(pyrimidin-5-ylmethyl)piperidin-3-yl]pyrazole-4-carboxamide |
| SMILES | CCNC(=O)c1cn(-c2ccccc2)nc1[C@@H]1CCCN(Cc2cncnc2)C1 |
| InChI | InChI=1S/C22H26N6O/c1-2-25-22(29)20-15-28(19-8-4-3-5-9-19)26-21(20)18-7-6-10-27(14-18)13-17-11-23-16-24-12-17/h3-5,8-9,11-12,15-16,18H,2,6-7,10,13-14H2,1H3,(H,25,29)/t18-/m1/s1 |
| InChIKey | MJBOTESIVVQSOU-GOSISDBHSA-N |
| XLogP | 2.79 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |