C14H18N4O3 — CID 128996092
5-(methoxymethyl)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)-1,2-oxazole-3-carboxamide (PubChem CID 128996092) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 128996092 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 5-(methoxymethyl)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCc1cc(C(=O)NCC2CCn3ccnc3C2)no1 |
| InChI | InChI=1S/C14H18N4O3/c1-20-9-11-7-12(17-21-11)14(19)16-8-10-2-4-18-5-3-15-13(18)6-10/h3,5,7,10H,2,4,6,8-9H2,1H3,(H,16,19) |
| InChIKey | JPAOOQIFMHTMEO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |