C13H16N4O2 — CID 129340499
5-methyl-N-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 129340499) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-methyl-N-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-methyl-N-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 129340499 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-methyl-N-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ocnc1C(=O)NC[C@H]1CCn2ccnc2C1 |
| InChI | InChI=1S/C13H16N4O2/c1-9-12(16-8-19-9)13(18)15-7-10-2-4-17-5-3-14-11(17)6-10/h3,5,8,10H,2,4,6-7H2,1H3,(H,15,18)/t10-/m0/s1 |
| InChIKey | XKHAVJNGHHOKPB-JTQLQIEISA-N |
| XLogP | 1.17 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |