C14H19N5O — CID 129331405
2,5-dimethyl-N-[[(7R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]pyrazole-3-carboxamide (PubChem CID 129331405) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 2,5-dimethyl-N-[[(7R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[[(7R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 129331405 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2,5-dimethyl-N-[[(7R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC[C@@H]2CCn3ccnc3C2)n(C)n1 |
| InChI | InChI=1S/C14H19N5O/c1-10-7-12(18(2)17-10)14(20)16-9-11-3-5-19-6-4-15-13(19)8-11/h4,6-7,11H,3,5,8-9H2,1-2H3,(H,16,20)/t11-/m1/s1 |
| InChIKey | JIEJRFZAPMHXSB-LLVKDONJSA-N |
| XLogP | 0.92 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |