C12H16N6OS — CID 129005521
1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)urea (PubChem CID 129005521) has the molecular formula C12H16N6OS and a molecular weight of 292.37 g/mol. Its IUPAC name is 1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)urea.
| Compound Name | 1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)urea |
|---|---|
| PubChem CID | 129005521 |
| Molecular Formula | C12H16N6OS |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)urea |
| SMILES | Cc1nnc(NC(=O)NCC2CCn3ccnc3C2)s1 |
| InChI | InChI=1S/C12H16N6OS/c1-8-16-17-12(20-8)15-11(19)14-7-9-2-4-18-5-3-13-10(18)6-9/h3,5,9H,2,4,6-7H2,1H3,(H2,14,15,17,19) |
| InChIKey | VDGGEPVAIVVCBN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |