C14H22N4O4S — CID 129003523
N-[1-(2-methylpyrazol-3-yl)-2-oxopiperidin-3-yl]-1-(oxolan-2-yl)methanesulfonamide (PubChem CID 129003523) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[1-(2-methylpyrazol-3-yl)-2-oxopiperidin-3-yl]-1-(oxolan-2-yl)methanesulfonamide.
| Compound Name | N-[1-(2-methylpyrazol-3-yl)-2-oxopiperidin-3-yl]-1-(oxolan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 129003523 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[1-(2-methylpyrazol-3-yl)-2-oxopiperidin-3-yl]-1-(oxolan-2-yl)methanesulfonamide |
| SMILES | Cn1nccc1N1CCCC(NS(=O)(=O)CC2CCCO2)C1=O |
| InChI | InChI=1S/C14H22N4O4S/c1-17-13(6-7-15-17)18-8-2-5-12(14(18)19)16-23(20,21)10-11-4-3-9-22-11/h6-7,11-12,16H,2-5,8-10H2,1H3 |
| InChIKey | FYVUBIHYMJBMOP-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |