C15H19N5O3S — CID 129327661
N-[(3S)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]pyridine-2-sulfonamide (PubChem CID 129327661) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is N-[(3S)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]pyridine-2-sulfonamide.
| Compound Name | N-[(3S)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 129327661 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[(3S)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]pyridine-2-sulfonamide |
| SMILES | CCn1nccc1N1CCC[C@H](NS(=O)(=O)c2ccccn2)C1=O |
| InChI | InChI=1S/C15H19N5O3S/c1-2-20-14(8-10-17-20)19-11-5-6-12(15(19)21)18-24(22,23)13-7-3-4-9-16-13/h3-4,7-10,12,18H,2,5-6,11H2,1H3/t12-/m0/s1 |
| InChIKey | VQYBAXFBOFUBQU-LBPRGKRZSA-N |
| XLogP | 0.77 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |