C14H17ClN4O3S2 — CID 129399904
5-chloro-N-[(3S)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]thiophene-2-sulfonamide (PubChem CID 129399904) has the molecular formula C14H17ClN4O3S2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 5-chloro-N-[(3S)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(3S)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 129399904 |
| Molecular Formula | C14H17ClN4O3S2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 5-chloro-N-[(3S)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]thiophene-2-sulfonamide |
| SMILES | CCn1nccc1N1CCC[C@H](NS(=O)(=O)c2ccc(Cl)s2)C1=O |
| InChI | InChI=1S/C14H17ClN4O3S2/c1-2-19-12(7-8-16-19)18-9-3-4-10(14(18)20)17-24(21,22)13-6-5-11(15)23-13/h5-8,10,17H,2-4,9H2,1H3/t10-/m0/s1 |
| InChIKey | CBFMNHMLACBILK-JTQLQIEISA-N |
| XLogP | 2.09 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |