C18H21N5O3S — CID 129399893
1-(3-cyanophenyl)-N-[(3R)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]methanesulfonamide (PubChem CID 129399893) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-N-[(3R)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]methanesulfonamide.
| Compound Name | 1-(3-cyanophenyl)-N-[(3R)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 129399893 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-(3-cyanophenyl)-N-[(3R)-1-(2-ethylpyrazol-3-yl)-2-oxopiperidin-3-yl]methanesulfonamide |
| SMILES | CCn1nccc1N1CCC[C@@H](NS(=O)(=O)Cc2cccc(C#N)c2)C1=O |
| InChI | InChI=1S/C18H21N5O3S/c1-2-23-17(8-9-20-23)22-10-4-7-16(18(22)24)21-27(25,26)13-15-6-3-5-14(11-15)12-19/h3,5-6,8-9,11,16,21H,2,4,7,10,13H2,1H3/t16-/m1/s1 |
| InChIKey | JYKCQXDKSJEYJE-MRXNPFEDSA-N |
| XLogP | 1.39 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |