C17H27N5O2S — CID 129004782
3,5-diethyl-N,1-dimethyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)pyrazole-4-sulfonamide (PubChem CID 129004782) has the molecular formula C17H27N5O2S and a molecular weight of 365.50 g/mol. Its IUPAC name is 3,5-diethyl-N,1-dimethyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)pyrazole-4-sulfonamide.
| Compound Name | 3,5-diethyl-N,1-dimethyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 129004782 |
| Molecular Formula | C17H27N5O2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 3,5-diethyl-N,1-dimethyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)pyrazole-4-sulfonamide |
| SMILES | CCc1nn(C)c(CC)c1S(=O)(=O)N(C)Cc1cn2c(n1)CCCC2 |
| InChI | InChI=1S/C17H27N5O2S/c1-5-14-17(15(6-2)21(4)19-14)25(23,24)20(3)11-13-12-22-10-8-7-9-16(22)18-13/h12H,5-11H2,1-4H3 |
| InChIKey | KTFANOUFILKEPC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |