C21H39N5O6 — CID 129008865
2-[[4-amino-2-(3-hydroxydodecanoylamino)-4-oxobutanoyl]amino]pentanediamide (PubChem CID 129008865) has the molecular formula C21H39N5O6 and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-[[4-amino-2-(3-hydroxydodecanoylamino)-4-oxobutanoyl]amino]pentanediamide.
| Compound Name | 2-[[4-amino-2-(3-hydroxydodecanoylamino)-4-oxobutanoyl]amino]pentanediamide |
|---|---|
| PubChem CID | 129008865 |
| Molecular Formula | C21H39N5O6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | 2-[[4-amino-2-(3-hydroxydodecanoylamino)-4-oxobutanoyl]amino]pentanediamide |
| SMILES | CCCCCCCCCC(O)CC(=O)NC(CC(N)=O)C(=O)NC(CCC(N)=O)C(N)=O |
| InChI | InChI=1S/C21H39N5O6/c1-2-3-4-5-6-7-8-9-14(27)12-19(30)25-16(13-18(23)29)21(32)26-15(20(24)31)10-11-17(22)28/h14-16,27H,2-13H2,1H3,(H2,22,28)(H2,23,29)(H2,24,31)(H,25,30)(H,26,32) |
| InChIKey | HUHSMTZGBMUTFN-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 207.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|