C16H30N2O5 — CID 90240727
(2S)-5-amino-2-(3-hydroxyundecanoylamino)-5-oxopentanoic acid (PubChem CID 90240727) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is (2S)-5-amino-2-(3-hydroxyundecanoylamino)-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-(3-hydroxyundecanoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 90240727 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (2S)-5-amino-2-(3-hydroxyundecanoylamino)-5-oxopentanoic acid |
| SMILES | CCCCCCCCC(O)CC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C16H30N2O5/c1-2-3-4-5-6-7-8-12(19)11-15(21)18-13(16(22)23)9-10-14(17)20/h12-13,19H,2-11H2,1H3,(H2,17,20)(H,18,21)(H,22,23)/t12?,13-/m0/s1 |
| InChIKey | LISGGRCRPULPLV-ABLWVSNPSA-N |
| XLogP | 1.32 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|