C8H20Cl2N2O4 — CID 129011902
(1R,3S,4R,6S)-4,6-bis(methylamino)cyclohexane-1,2,3,5-tetrol;dihydrochloride (PubChem CID 129011902) has the molecular formula C8H20Cl2N2O4 and a molecular weight of 279.16 g/mol. Its IUPAC name is (1R,3S,4R,6S)-4,6-bis(methylamino)cyclohexane-1,2,3,5-tetrol;dihydrochloride.
| Compound Name | (1R,3S,4R,6S)-4,6-bis(methylamino)cyclohexane-1,2,3,5-tetrol;dihydrochloride |
|---|---|
| PubChem CID | 129011902 |
| Molecular Formula | C8H20Cl2N2O4 |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (1R,3S,4R,6S)-4,6-bis(methylamino)cyclohexane-1,2,3,5-tetrol;dihydrochloride |
| SMILES | CN[C@@H]1C(O)[C@H](NC)[C@@H](O)C(O)[C@H]1O.Cl.Cl |
| InChI | InChI=1S/C8H18N2O4.2ClH/c1-9-3-5(11)4(10-2)7(13)8(14)6(3)12;;/h3-14H,1-2H3;2*1H/t3-,4+,5?,6+,7-,8?;; |
| InChIKey | FBEYLEBLKPGEJY-PZTBLVBHSA-N |
| XLogP | -2.54 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |