C18H14ClN3O2 — CID 129017698
3-[2-(4-chloro-2-ethenylphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]propanal (PubChem CID 129017698) has the molecular formula C18H14ClN3O2 and a molecular weight of 339.78 g/mol. Its IUPAC name is 3-[2-(4-chloro-2-ethenylphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]propanal.
| Compound Name | 3-[2-(4-chloro-2-ethenylphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]propanal |
|---|---|
| PubChem CID | 129017698 |
| Molecular Formula | C18H14ClN3O2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 3-[2-(4-chloro-2-ethenylphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]propanal |
| SMILES | C=Cc1cc(Cl)ccc1-c1nc2cccnc2n(CCC=O)c1=O |
| InChI | InChI=1S/C18H14ClN3O2/c1-2-12-11-13(19)6-7-14(12)16-18(24)22(9-4-10-23)17-15(21-16)5-3-8-20-17/h2-3,5-8,10-11H,1,4,9H2 |
| InChIKey | QWHLCCHLEFUNRD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|