About 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid
2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid (PubChem CID 134146352) has the molecular formula C15H11N3O5
and a molecular weight of 313.27 g/mol. Its IUPAC name is 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid |
| PubChem CID | 134146352 |
| Molecular Formula | C15H11N3O5 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid |
| SMILES | O=C(O)Cn1c(=O)c(-c2cc(O)cc(O)c2)nc2cccnc21 |
| InChI | InChI=1S/C15H11N3O5/c19-9-4-8(5-10(20)6-9)13-15(23)18(7-12(21)22)14-11(17-13)2-1-3-16-14/h1-6,19-20H,7H2,(H,21,22) |
| InChIKey | BJRFYXDWCZLUDU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid?
The IUPAC name of 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid (CID 134146352) is 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid?
The canonical SMILES for 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid is O=C(O)Cn1c(=O)c(-c2cc(O)cc(O)c2)nc2cccnc21.
What is the InChIKey of 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid?
The InChIKey is BJRFYXDWCZLUDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O5/c19-9-4-8(5-10(20)6-9)13-15(23)18(7-12(21)22)14-11(17-13)2-1-3-16-14/h1-6,19-20H,7H2,(H,21,22).
What are the key properties of 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid?
2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid has a molecular weight of 313.27 g/mol, XLogP of 0.95, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dihydroxyphenyl)-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid is sourced from PubChem (CID 134146352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).