C34H42O7 — CID 129018622
3-O-hex-5-enyl 1-O-hexyl 5-(3-formyl-5-hex-5-enoxycarbonylphenyl)benzene-1,3-dicarboxylate (PubChem CID 129018622) has the molecular formula C34H42O7 and a molecular weight of 562.70 g/mol. Its IUPAC name is 3-O-hex-5-enyl 1-O-hexyl 5-(3-formyl-5-hex-5-enoxycarbonylphenyl)benzene-1,3-dicarboxylate.
| Compound Name | 3-O-hex-5-enyl 1-O-hexyl 5-(3-formyl-5-hex-5-enoxycarbonylphenyl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 129018622 |
| Molecular Formula | C34H42O7 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 3-O-hex-5-enyl 1-O-hexyl 5-(3-formyl-5-hex-5-enoxycarbonylphenyl)benzene-1,3-dicarboxylate |
| SMILES | C=CCCCCOC(=O)c1cc(C=O)cc(-c2cc(C(=O)OCCCCC=C)cc(C(=O)OCCCCCC)c2)c1 |
| InChI | InChI=1S/C34H42O7/c1-4-7-10-13-16-39-32(36)29-20-26(25-35)19-27(21-29)28-22-30(33(37)40-17-14-11-8-5-2)24-31(23-28)34(38)41-18-15-12-9-6-3/h4-5,19-25H,1-2,6-18H2,3H3 |
| InChIKey | QMEZWRXMKYMPRR-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|