C46H56O8 — CID 129018683
3-O-hex-5-enyl 1-O-hexyl 5-[4-[3,5-bis(hex-5-enoxycarbonyl)phenyl]phenyl]benzene-1,3-dicarboxylate (PubChem CID 129018683) has the molecular formula C46H56O8 and a molecular weight of 736.95 g/mol. Its IUPAC name is 3-O-hex-5-enyl 1-O-hexyl 5-[4-[3,5-bis(hex-5-enoxycarbonyl)phenyl]phenyl]benzene-1,3-dicarboxylate.
| Compound Name | 3-O-hex-5-enyl 1-O-hexyl 5-[4-[3,5-bis(hex-5-enoxycarbonyl)phenyl]phenyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 129018683 |
| Molecular Formula | C46H56O8 |
| Molecular Weight | 736.95 g/mol |
| Exact Mass | 736.40 |
| IUPAC Name | 3-O-hex-5-enyl 1-O-hexyl 5-[4-[3,5-bis(hex-5-enoxycarbonyl)phenyl]phenyl]benzene-1,3-dicarboxylate |
| SMILES | C=CCCCCOC(=O)c1cc(C(=O)OCCCCC=C)cc(-c2ccc(-c3cc(C(=O)OCCCCC=C)cc(C(=O)OCCCCCC)c3)cc2)c1 |
| InChI | InChI=1S/C46H56O8/c1-5-9-13-17-25-51-43(47)39-29-37(30-40(33-39)44(48)52-26-18-14-10-6-2)35-21-23-36(24-22-35)38-31-41(45(49)53-27-19-15-11-7-3)34-42(32-38)46(50)54-28-20-16-12-8-4/h5-7,21-24,29-34H,1-3,8-20,25-28H2,4H3 |
| InChIKey | NEGGYOVYXAMPML-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.95 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|