C41H48O8S — CID 129018679
3-O-hex-5-enyl 1-O-propyl 5-[5-[3,5-bis(hex-5-enoxycarbonyl)phenyl]thiophen-2-yl]benzene-1,3-dicarboxylate (PubChem CID 129018679) has the molecular formula C41H48O8S and a molecular weight of 700.89 g/mol. Its IUPAC name is 3-O-hex-5-enyl 1-O-propyl 5-[5-[3,5-bis(hex-5-enoxycarbonyl)phenyl]thiophen-2-yl]benzene-1,3-dicarboxylate.
| Compound Name | 3-O-hex-5-enyl 1-O-propyl 5-[5-[3,5-bis(hex-5-enoxycarbonyl)phenyl]thiophen-2-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 129018679 |
| Molecular Formula | C41H48O8S |
| Molecular Weight | 700.89 g/mol |
| Exact Mass | 700.31 |
| IUPAC Name | 3-O-hex-5-enyl 1-O-propyl 5-[5-[3,5-bis(hex-5-enoxycarbonyl)phenyl]thiophen-2-yl]benzene-1,3-dicarboxylate |
| SMILES | C=CCCCCOC(=O)c1cc(C(=O)OCCC)cc(-c2ccc(-c3cc(C(=O)OCCCCC=C)cc(C(=O)OCCCCC=C)c3)s2)c1 |
| InChI | InChI=1S/C41H48O8S/c1-5-9-12-15-21-47-39(43)33-25-30(24-32(28-33)38(42)46-20-8-4)36-18-19-37(50-36)31-26-34(40(44)48-22-16-13-10-6-2)29-35(27-31)41(45)49-23-17-14-11-7-3/h5-7,18-19,24-29H,1-3,8-17,20-23H2,4H3 |
| InChIKey | ODNCAPWAEHAVME-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.89 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|