C21H34N2 — CID 129022754
3-methyl-2-(1-phenylpropylamino)-3-propyloctanenitrile (PubChem CID 129022754) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 3-methyl-2-(1-phenylpropylamino)-3-propyloctanenitrile.
| Compound Name | 3-methyl-2-(1-phenylpropylamino)-3-propyloctanenitrile |
|---|---|
| PubChem CID | 129022754 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | 3-methyl-2-(1-phenylpropylamino)-3-propyloctanenitrile |
| SMILES | CCCCCC(C)(CCC)C(C#N)NC(CC)c1ccccc1 |
| InChI | InChI=1S/C21H34N2/c1-5-8-12-16-21(4,15-6-2)20(17-22)23-19(7-3)18-13-10-9-11-14-18/h9-11,13-14,19-20,23H,5-8,12,15-16H2,1-4H3 |
| InChIKey | BFVDKTGTXYPYLL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|