C26H24FN3O3S — CID 129025703
2-[[(3R)-1-[5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 129025703) has the molecular formula C26H24FN3O3S and a molecular weight of 477.56 g/mol. Its IUPAC name is 2-[[(3R)-1-[5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(3R)-1-[5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 129025703 |
| Molecular Formula | C26H24FN3O3S |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-[[(3R)-1-[5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1nc(C(=O)N2CCC[C@@H](C)C2CN2C(=O)c3ccccc3C2=O)c(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C26H24FN3O3S/c1-15-6-5-13-29(21(15)14-30-24(31)19-7-3-4-8-20(19)25(30)32)26(33)22-23(34-16(2)28-22)17-9-11-18(27)12-10-17/h3-4,7-12,15,21H,5-6,13-14H2,1-2H3/t15-,21?/m1/s1 |
| InChIKey | ILVWKYIVOSGZMD-RBFZIWAESA-N |
| XLogP | 4.79 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|