C22H20ClIN2O3 — CID 118309943
2-[[1-(5-chloro-2-iodobenzoyl)-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 118309943) has the molecular formula C22H20ClIN2O3 and a molecular weight of 522.77 g/mol. Its IUPAC name is 2-[[1-(5-chloro-2-iodobenzoyl)-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[1-(5-chloro-2-iodobenzoyl)-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118309943 |
| Molecular Formula | C22H20ClIN2O3 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | 2-[[1-(5-chloro-2-iodobenzoyl)-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | CC1CCCN(C(=O)c2cc(Cl)ccc2I)C1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H20ClIN2O3/c1-13-5-4-10-25(22(29)17-11-14(23)8-9-18(17)24)19(13)12-26-20(27)15-6-2-3-7-16(15)21(26)28/h2-3,6-9,11,13,19H,4-5,10,12H2,1H3 |
| InChIKey | RSOZEURMOJGXSQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|