C23H23IN2O3 — CID 118310020
2-[[1-(2-iodo-5-methylbenzoyl)-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 118310020) has the molecular formula C23H23IN2O3 and a molecular weight of 502.35 g/mol. Its IUPAC name is 2-[[1-(2-iodo-5-methylbenzoyl)-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[1-(2-iodo-5-methylbenzoyl)-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118310020 |
| Molecular Formula | C23H23IN2O3 |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 2-[[1-(2-iodo-5-methylbenzoyl)-3-methylpiperidin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(I)c(C(=O)N2CCCC(C)C2CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H23IN2O3/c1-14-9-10-19(24)18(12-14)23(29)25-11-5-6-15(2)20(25)13-26-21(27)16-7-3-4-8-17(16)22(26)28/h3-4,7-10,12,15,20H,5-6,11,13H2,1-2H3 |
| InChIKey | NVGWDLWUPWUFOI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|