C19H24N2O3 — CID 51192239
5-methyl-2-[4-(2-methylpiperidin-1-yl)-4-oxobutyl]isoindole-1,3-dione (PubChem CID 51192239) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 5-methyl-2-[4-(2-methylpiperidin-1-yl)-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 5-methyl-2-[4-(2-methylpiperidin-1-yl)-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 51192239 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 5-methyl-2-[4-(2-methylpiperidin-1-yl)-4-oxobutyl]isoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)N1CCCCC1C)C2=O |
| InChI | InChI=1S/C19H24N2O3/c1-13-8-9-15-16(12-13)19(24)21(18(15)23)11-5-7-17(22)20-10-4-3-6-14(20)2/h8-9,12,14H,3-7,10-11H2,1-2H3 |
| InChIKey | VHJQDUREUCEPCI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|