C20H24N2O4 — CID 55806517
2-[3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-3-oxopropyl]-5-methylisoindole-1,3-dione (PubChem CID 55806517) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-3-oxopropyl]-5-methylisoindole-1,3-dione.
| Compound Name | 2-[3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-3-oxopropyl]-5-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 55806517 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-3-oxopropyl]-5-methylisoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)N1CCOC3CCCCC31)C2=O |
| InChI | InChI=1S/C20H24N2O4/c1-13-6-7-14-15(12-13)20(25)22(19(14)24)9-8-18(23)21-10-11-26-17-5-3-2-4-16(17)21/h6-7,12,16-17H,2-5,8-11H2,1H3 |
| InChIKey | JDRKRIKJERUQBI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|